![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
.thedecember drive | 20-Apr-2018 16:20 | - | |
|
1789 | 20-Apr-2018 16:20 | - | |
|
3 Med Och En Utan | 20-Apr-2018 16:20 | - | |
|
4t1a (quart primera) | 20-Apr-2018 16:20 | - | |
|
5vor12 | 20-Apr-2018 16:20 | - | |
|
7HOUSE | 20-Apr-2018 16:20 | - | |
|
AX-11 | 20-Apr-2018 16:20 | - | |
|
Agharta | 20-Apr-2018 16:20 | - | |
|
Alain Thibault | 20-Apr-2018 16:20 | - | |
|
Albert Brooks | 20-Apr-2018 16:20 | - | |
|
Aldo Donà | 20-Apr-2018 16:20 | - | |
|
Aleksander Arder | 20-Apr-2018 16:20 | - | |
|
Amanda Lepre feat. Stemage | 20-Apr-2018 16:20 | - | |
|
Analogue Monsta | 20-Apr-2018 16:20 | - | |
|
Andreas melcom Urban | 20-Apr-2018 16:20 | - | |
|
Animals of the Forest | 20-Apr-2018 16:20 | - | |
|
Annwn | 20-Apr-2018 16:20 | - | |
|
Antagonist | 20-Apr-2018 16:20 | - | |
|
Antonio Resines | 20-Apr-2018 16:20 | - | |
|
Any Old Time | 20-Apr-2018 16:20 | - | |
|
Anylulu | 20-Apr-2018 16:20 | - | |
|
Apopocalyps | 20-Apr-2018 16:20 | - | |
|
Associazione Culturale Coro Musirè | 20-Apr-2018 16:20 | - | |
|
Azeazeron | 20-Apr-2018 16:20 | - | |
|
Before I Go | 20-Apr-2018 16:20 | - | |
|
Ben Albu | 20-Apr-2018 16:20 | - | |
|
Benna | 20-Apr-2018 16:20 | - | |
|
Bernd Grashoff | 20-Apr-2018 16:20 | - | |
|
Big Face Grace | 20-Apr-2018 16:20 | - | |
|
Bill Keis | 20-Apr-2018 16:20 | - | |
|
Binder | 20-Apr-2018 16:20 | - | |
|
Bisz | 20-Apr-2018 16:20 | - | |
|
Blackout Music | 20-Apr-2018 16:20 | - | |
|
Bleedience | 20-Apr-2018 16:20 | - | |
|
Blood Orange | 20-Apr-2018 16:20 | - | |
|
Blue 4U | 20-Apr-2018 16:20 | - | |
|
Bobby Sheridan | 20-Apr-2018 16:20 | - | |
|
Bona Roba | 20-Apr-2018 16:20 | - | |
|
Boring | 20-Apr-2018 16:20 | - | |
|
Captain Kangaroo | 20-Apr-2018 16:20 | - | |
|
Carlo Rustichelli & Piero Umiliani | 20-Apr-2018 16:20 | - | |
|
Carlos Piñana | 20-Apr-2018 16:20 | - | |
|
Cellolitis | 20-Apr-2018 16:20 | - | |
|
Chain | 20-Apr-2018 16:20 | - | |
|
China Dolls | 20-Apr-2018 16:20 | - | |
|
Chirleison | 20-Apr-2018 16:20 | - | |
|
Cinemagic | 20-Apr-2018 16:20 | - | |
|
Clarence Spady | 20-Apr-2018 16:20 | - | |
|
Clemilda | 20-Apr-2018 16:20 | - | |
|
Colorado Rangers | 20-Apr-2018 16:20 | - | |
|
Cvees | 20-Apr-2018 16:20 | - | |
|
D. Kay + Mat | 20-Apr-2018 16:20 | - | |
|
DJ Fox & seine Gang | 20-Apr-2018 16:20 | - | |
|
Dana Kern | 20-Apr-2018 16:20 | - | |
|
Daniel Costa | 20-Apr-2018 16:20 | - | |
|
Dank | 20-Apr-2018 16:20 | - | |
|
Darren Hayman & The Long Parliament | 20-Apr-2018 16:20 | - | |
|
Debaba et Soukous Stars | 20-Apr-2018 16:20 | - | |
|
Delusions of Grandeur | 20-Apr-2018 16:20 | - | |
|
Die Vinschger | 20-Apr-2018 16:20 | - | |
|
Doctor Love | 20-Apr-2018 16:20 | - | |
|
Dorléac | 20-Apr-2018 16:20 | - | |
|
Dudley Callicutt & The "Go" Boys | 20-Apr-2018 16:20 | - | |
|
Dukkha | 20-Apr-2018 16:20 | - | |
|
ENT | 20-Apr-2018 16:20 | - | |
|
Edwin Finckel | 20-Apr-2018 16:20 | - | |
|
El Tiempo | 20-Apr-2018 16:20 | - | |
|
Elfes | 20-Apr-2018 16:20 | - | |
|
Embellish | 20-Apr-2018 16:20 | - | |
|
Energy Vampires | 20-Apr-2018 16:20 | - | |
|
Ensemble Wayal | 20-Apr-2018 16:20 | - | |
|
Fabio Mignola | 20-Apr-2018 16:20 | - | |
|
Fleischschritt Marsch | 20-Apr-2018 16:20 | - | |
|
Four Mod | 20-Apr-2018 16:20 | - | |
|
Full Swing | 20-Apr-2018 16:20 | - | |
|
Get Better | 20-Apr-2018 16:20 | - | |
|
Ghost Machine | 20-Apr-2018 16:20 | - | |
|
Godsize | 20-Apr-2018 16:20 | - | |
|
Gus and Frank | 20-Apr-2018 16:20 | - | |
|
Harvey Levin | 20-Apr-2018 16:20 | - | |
|
Hazey Jane | 20-Apr-2018 16:20 | - | |
|
Hen:ge | 20-Apr-2018 16:20 | - | |
|
Hey Today! | 20-Apr-2018 16:20 | - | |
|
High Plains Drifters | 20-Apr-2018 16:20 | - | |
|
Hypokras | 20-Apr-2018 16:20 | - | |
|
INDIGO 4 | 20-Apr-2018 16:20 | - | |
|
Ilves, Pulk ja Rahman | 20-Apr-2018 16:20 | - | |
|
Inners | 20-Apr-2018 16:20 | - | |
|
Jae-P | 20-Apr-2018 16:20 | - | |
|
Jarkko ja Laura | 20-Apr-2018 16:20 | - | |
|
Javiera & Los Imposibles | 20-Apr-2018 16:20 | - | |
|
Jennifer Gentle & Kawabata Makoto | 20-Apr-2018 16:20 | - | |
|
Jimmy Gonzalez y el Grupo Mazz | 20-Apr-2018 16:20 | - | |
|
Johanna Grüssner & Mika Pohjola | 20-Apr-2018 16:20 | - | |
|
John McBain | 20-Apr-2018 16:20 | - | |
|
Karin Viard | 20-Apr-2018 16:20 | - | |
|
Kasatka | 20-Apr-2018 16:20 | - | |
|
Kaupunginorkesteri | 20-Apr-2018 16:20 | - | |
|
Ko Kimura | 20-Apr-2018 16:20 | - | |
|
Kristen Barry | 20-Apr-2018 16:20 | - | |
|
Kujoma | 20-Apr-2018 16:20 | - | |
|
L'Enfance éternelle | 20-Apr-2018 16:20 | - | |
|
La Clase | 20-Apr-2018 16:20 | - | |
|
Lee Galloway | 20-Apr-2018 16:20 | - | |
|
Leni Ward | 20-Apr-2018 16:20 | - | |
|
Leonel Limonta Y Azucar Negra | 20-Apr-2018 16:20 | - | |
|
Les Fossoyeurs | 20-Apr-2018 16:20 | - | |
|
Lesbian and Gay Chorus of D.C. | 20-Apr-2018 16:20 | - | |
|
Liam Gerner | 20-Apr-2018 16:20 | - | |
|
Little Joe Washington | 20-Apr-2018 16:20 | - | |
|
Los Niños | 20-Apr-2018 16:20 | - | |
|
Los Perdidos | 20-Apr-2018 16:20 | - | |
|
Lourds Lane | 20-Apr-2018 16:20 | - | |
|
M. Bentley | 20-Apr-2018 16:20 | - | |
|
M.E. | 20-Apr-2018 16:20 | - | |
|
MM (Victor) Marceau, Accordéoniste Virtuose | 20-Apr-2018 16:20 | - | |
|
Maarja | 20-Apr-2018 16:20 | - | |
|
Mad Professor meets Marcelinho da Lua | 20-Apr-2018 16:20 | - | |
|
Magdalene Keibel Combo | 20-Apr-2018 16:20 | - | |
|
Makali | 20-Apr-2018 16:20 | - | |
|
Mannafest | 20-Apr-2018 16:20 | - | |
|
Marco Carola & Gaetano Parisio | 20-Apr-2018 16:20 | - | |
|
Marika Krook | 20-Apr-2018 16:20 | - | |
|
Mario Fargetta | 20-Apr-2018 16:20 | - | |
|
Meadows End | 20-Apr-2018 16:20 | - | |
|
Mick Hucknall & The Frantic Elevators | 20-Apr-2018 16:20 | - | |
|
Midi Matilda | 20-Apr-2018 16:20 | - | |
|
Mike Dunn & The Kings of New England | 20-Apr-2018 16:20 | - | |
|
Mind Distortion System | 20-Apr-2018 16:20 | - | |
|
Mire | 20-Apr-2018 16:20 | - | |
|
Mojácar Flamenco | 20-Apr-2018 16:20 | - | |
|
Monx | 20-Apr-2018 16:20 | - | |
|
Mordicus | 20-Apr-2018 16:20 | - | |
|
More | 20-Apr-2018 16:20 | - | |
|
Murilo Osório | 20-Apr-2018 16:20 | - | |
|
N.A.O.S. | 20-Apr-2018 16:20 | - | |
|
Nejat Alp | 20-Apr-2018 16:20 | - | |
|
Neon Cage Experiment | 20-Apr-2018 16:20 | - | |
|
Niet Schieten! | 20-Apr-2018 16:20 | - | |
|
Nightrace | 20-Apr-2018 16:20 | - | |
|
Nikkfurie | 20-Apr-2018 16:20 | - | |
|
Nitrogen | 20-Apr-2018 16:20 | - | |
|
No Bra | 20-Apr-2018 16:20 | - | |
|
Nuca | 20-Apr-2018 16:20 | - | |
|
O'Neill | 20-Apr-2018 16:20 | - | |
|
Oakwood College USM | 20-Apr-2018 16:20 | - | |
|
Octolab | 20-Apr-2018 16:20 | - | |
|
Ogeday & Işın Karaca | 20-Apr-2018 16:20 | - | |
|
Olivier Giacomotto | 20-Apr-2018 16:20 | - | |
|
Omnia feat. Melissa Loretta | 20-Apr-2018 16:20 | - | |
|
Orange | 20-Apr-2018 16:20 | - | |
|
P.H.T.O. | 20-Apr-2018 16:20 | - | |
|
Pan Psychic | 20-Apr-2018 16:20 | - | |
|
Pete Townshend & Raphael Rudd | 20-Apr-2018 16:20 | - | |
|
Phyllis Warner | 20-Apr-2018 16:20 | - | |
|
Pierre Ström & Finn Zetterholm | 20-Apr-2018 16:20 | - | |
|
PlankMen | 20-Apr-2018 16:20 | - | |
|
Popol Lavanchy | 20-Apr-2018 16:20 | - | |
|
Prince Far I & King Tubby | 20-Apr-2018 16:20 | - | |
|
Proyecto Mayhem | 20-Apr-2018 16:20 | - | |
|
Quake Matthews | 20-Apr-2018 16:20 | - | |
|
Rattleshake | 20-Apr-2018 16:20 | - | |
|
Rayneke | 20-Apr-2018 16:20 | - | |
|
Rebecca Barclay & John Steele | 20-Apr-2018 16:20 | - | |
|
Reiner Witzel | 20-Apr-2018 16:20 | - | |
|
Rell feat. Jay-Z | 20-Apr-2018 16:20 | - | |
|
Requiem | 20-Apr-2018 16:20 | - | |
|
Revolutionary Army of California | 20-Apr-2018 16:20 | - | |
|
Rheinallt H Rowlands | 20-Apr-2018 16:20 | - | |
|
Richard Kates | 20-Apr-2018 16:20 | - | |
|
Rickey Woodard | 20-Apr-2018 16:20 | - | |
|
Rob Schwimmer ⁄ Uri Caine ⁄ Mark Feldman | 20-Apr-2018 16:20 | - | |
|
Robert Thomas | 20-Apr-2018 16:20 | - | |
|
Rockland Ladies | 20-Apr-2018 16:20 | - | |
|
R|A|A|N | 20-Apr-2018 16:20 | - | |
|
Sabastian Boaz | 20-Apr-2018 16:20 | - | |
|
Safari Sounds | 20-Apr-2018 16:20 | - | |
|
Sam Sklair | 20-Apr-2018 16:20 | - | |
|
Samantha Lombardi | 20-Apr-2018 16:20 | - | |
|
Satellite 66 | 20-Apr-2018 16:20 | - | |
|
Say Hello to My Kids | 20-Apr-2018 16:20 | - | |
|
Silent Process | 20-Apr-2018 16:20 | - | |
|
Simon James French | 20-Apr-2018 16:20 | - | |
|
Sing4Joy | 20-Apr-2018 16:20 | - | |
|
Smokie & Suzi Quatro | 20-Apr-2018 16:20 | - | |
|
Soniq Vision | 20-Apr-2018 16:20 | - | |
|
Sound Enforcer | 20-Apr-2018 16:20 | - | |
|
Sparklehorse + Fennesz | 20-Apr-2018 16:20 | - | |
|
Spider Robinson | 20-Apr-2018 16:20 | - | |
|
Stealing Jane | 20-Apr-2018 16:20 | - | |
|
Stereolab & Nurse With Wound | 20-Apr-2018 16:20 | - | |
|
Steve Wallace | 20-Apr-2018 16:20 | - | |
|
Strip Steve & Das Glow | 20-Apr-2018 16:20 | - | |
|
Sugar Shack | 20-Apr-2018 16:20 | - | |
|
Surface Empire | 20-Apr-2018 16:20 | - | |
|
TMC ALLSTARS | 20-Apr-2018 16:20 | - | |
|
Tamika Patton | 20-Apr-2018 16:20 | - | |
|
Tang! | 20-Apr-2018 16:20 | - | |
|
Tear Gas and Plate Glass | 20-Apr-2018 16:20 | - | |
|
Telafonica | 20-Apr-2018 16:20 | - | |
|
Ten Wheel Drive | 20-Apr-2018 16:20 | - | |
|
Teutrine | 20-Apr-2018 16:20 | - | |
|
Thad Cockrell | 20-Apr-2018 16:20 | - | |
|
The Bad Machines | 20-Apr-2018 16:20 | - | |
|
The Blind Circus | 20-Apr-2018 16:20 | - | |
|
The Brood | 20-Apr-2018 16:20 | - | |
|
The Busdrivers | 20-Apr-2018 16:20 | - | |
|
The Cheeky White Devils | 20-Apr-2018 16:20 | - | |
|
The David Rutland Band | 20-Apr-2018 16:20 | - | |
|
The Fashion | 20-Apr-2018 16:20 | - | |
|
The Floor Is Made of Lava | 20-Apr-2018 16:20 | - | |
|
The Hand to Man Band | 20-Apr-2018 16:20 | - | |
|
The Insects & Richard Grassby-Lewis featuring Jon Hassell | 20-Apr-2018 16:20 | - | |
|
The Last Felony | 20-Apr-2018 16:20 | - | |
|
The Outdoor Types | 20-Apr-2018 16:20 | - | |
|
The Proclivities | 20-Apr-2018 16:20 | - | |
|
The Robin Nolan Swing Quartet | 20-Apr-2018 16:20 | - | |
|
The Unireverse | 20-Apr-2018 16:20 | - | |
|
Timothy Fountain | 20-Apr-2018 16:20 | - | |
|
Tomas Korber | 20-Apr-2018 16:20 | - | |
|
Too Short Notice | 20-Apr-2018 16:20 | - | |
|
Trio Sabiá | 20-Apr-2018 16:20 | - | |
|
Ty Nikdy | 20-Apr-2018 16:20 | - | |
|
Ultraviolet | 20-Apr-2018 16:20 | - | |
|
V.E.T.O. | 20-Apr-2018 16:20 | - | |
|
Viba Femba | 20-Apr-2018 16:20 | - | |
|
Vitiello ⁄ Bode ⁄ Deutsch | 20-Apr-2018 16:20 | - | |
|
William Becton & Friends | 20-Apr-2018 16:20 | - | |
|
Wim Claeys, Frédéric Paris, Gilles Chabenat et Maarten Decombel | 20-Apr-2018 16:20 | - | |
|
Wishnik | 20-Apr-2018 16:20 | - | |
|
Wolves Carry My Name | 20-Apr-2018 16:20 | - | |
|
Xrabit + DMG$ | 20-Apr-2018 16:20 | - | |
|
Yoda | 20-Apr-2018 16:20 | - | |
|
Zapp & Mr. Capone-E | 20-Apr-2018 16:20 | - | |
|
ab & xmz | 20-Apr-2018 16:20 | - | |
|
cuetracks | 20-Apr-2018 16:20 | - | |
|
death+qpid | 20-Apr-2018 16:20 | - | |
|
dr.no | 20-Apr-2018 16:20 | - | |
|
dreamSTATE | 20-Apr-2018 16:20 | - | |
|
mmd | 20-Apr-2018 16:20 | - | |
|
moveto - Axel Kornmesser & Markus Löffler | 20-Apr-2018 16:20 | - | |
|
pnmf! | 20-Apr-2018 16:20 | - | |
|
Κώστας Θεοδώρου | 20-Apr-2018 16:20 | - | |
|
ДМЦ | 20-Apr-2018 16:20 | - | |
|
Мастер ШеFF | 20-Apr-2018 16:20 | - | |
|
Нэнси | 20-Apr-2018 16:20 | - | |
|
林原めぐみ & 保志総一朗 | 20-Apr-2018 16:20 | - | |
|
江幡育子 | 20-Apr-2018 16:20 | - | |
|
洪暐 | 20-Apr-2018 16:20 | - | |
|
璽恩 | 20-Apr-2018 16:20 | - | |